C32H44O9 — CID 74941717
[4-acetyloxy-9-hydroxy-3,6,6,10,14-pentamethyl-13-(2-methylbut-2-enoyloxy)-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbut-2-enoate (PubChem CID 74941717) has the molecular formula C32H44O9 and a molecular weight of 572.70 g/mol. Its IUPAC name is [4-acetyloxy-9-hydroxy-3,6,6,10,14-pentamethyl-13-(2-methylbut-2-enoyloxy)-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbut-2-enoate.
| Compound Name | [4-acetyloxy-9-hydroxy-3,6,6,10,14-pentamethyl-13-(2-methylbut-2-enoyloxy)-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 74941717 |
| Molecular Formula | C32H44O9 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [4-acetyloxy-9-hydroxy-3,6,6,10,14-pentamethyl-13-(2-methylbut-2-enoyloxy)-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(O)C(C)=CC23OC2(CC(C)C3OC(=O)C(C)=CC)C(=O)C(C)C(OC(C)=O)C2C1C2(C)C |
| InChI | InChI=1S/C32H44O9/c1-11-15(3)28(36)39-25-22-21(30(22,9)10)24(38-20(8)33)19(7)26(35)31-14-18(6)27(40-29(37)16(4)12-2)32(31,41-31)13-17(5)23(25)34/h11-13,18-19,21-25,27,34H,14H2,1-10H3 |
| InChIKey | MXZPVULUCINOMS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|