C28H40O8 — CID 177401807
[(1S,2E,4R,7Z,9R,11R,13S,14S)-14-acetyloxy-6-(2-hydroxypropan-2-yl)-5-methoxy-3,9,13-trimethyl-10-oxo-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 177401807) has the molecular formula C28H40O8 and a molecular weight of 504.62 g/mol. Its IUPAC name is [(1S,2E,4R,7Z,9R,11R,13S,14S)-14-acetyloxy-6-(2-hydroxypropan-2-yl)-5-methoxy-3,9,13-trimethyl-10-oxo-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,2E,4R,7Z,9R,11R,13S,14S)-14-acetyloxy-6-(2-hydroxypropan-2-yl)-5-methoxy-3,9,13-trimethyl-10-oxo-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 177401807 |
| Molecular Formula | C28H40O8 |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | [(1S,2E,4R,7Z,9R,11R,13S,14S)-14-acetyloxy-6-(2-hydroxypropan-2-yl)-5-methoxy-3,9,13-trimethyl-10-oxo-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1/C(C)=C/[C@@]23O[C@@]2(C[C@H](C)[C@@H]3OC(C)=O)C(=O)[C@H](C)/C=C\C(C(C)(C)O)C1OC |
| InChI | InChI=1S/C28H40O8/c1-10-15(2)25(31)35-21-17(4)13-28-24(34-19(6)29)18(5)14-27(28,36-28)23(30)16(3)11-12-20(22(21)33-9)26(7,8)32/h10-13,16,18,20-22,24,32H,14H2,1-9H3/b12-11-,15-10-,17-13+/t16-,18+,20?,21-,22?,24+,27+,28+/m1/s1 |
| InChIKey | RAIAAHODDGFVPW-CWMYNYLWSA-N |
| XLogP | 3.47 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|