C31H38O9 — CID 177486214
[(1R,3R,4R,5R,7S,9R,10E,12S,13R,14R)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate (PubChem CID 177486214) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is [(1R,3R,4R,5R,7S,9R,10E,12S,13R,14R)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate.
| Compound Name | [(1R,3R,4R,5R,7S,9R,10E,12S,13R,14R)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate |
|---|---|
| PubChem CID | 177486214 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | [(1R,3R,4R,5R,7S,9R,10E,12S,13R,14R)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@H](C(OC(=O)c3ccccc3)[C@H](OC(C)=O)/C(C)=C/[C@@]34O[C@@]3(C[C@@H](C)[C@H]4O)C(=O)[C@@H]1C)C2(C)C |
| InChI | InChI=1S/C31H38O9/c1-15-13-30-26(34)16(2)14-31(30,40-30)27(35)17(3)24(38-19(5)33)21-22(29(21,6)7)25(23(15)37-18(4)32)39-28(36)20-11-9-8-10-12-20/h8-13,16-17,21-26,34H,14H2,1-7H3/b15-13+/t16-,17-,21+,22-,23-,24+,25?,26-,30+,31+/m1/s1 |
| InChIKey | LUZIRMMIUVNGNO-KCYNHJSOSA-N |
| XLogP | 3.42 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|