C35H44O11 — CID 57363316
2-(4-methoxyphenyl)-2-(4,8,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl)acetic acid (PubChem CID 57363316) has the molecular formula C35H44O11 and a molecular weight of 640.73 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-(4,8,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl)acetic acid.
| Compound Name | 2-(4-methoxyphenyl)-2-(4,8,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl)acetic acid |
|---|---|
| PubChem CID | 57363316 |
| Molecular Formula | C35H44O11 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-(4,8,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl)acetic acid |
| SMILES | COc1ccc(C(C(=O)O)C2C(C)=CC34OC3(CC(C)C4OC(C)=O)C(=O)C(C)C(OC(C)=O)C3C(C2OC(C)=O)C3(C)C)cc1 |
| InChI | InChI=1S/C35H44O11/c1-16-14-35-31(45-21(6)38)17(2)15-34(35,46-35)30(39)18(3)28(43-19(4)36)26-27(33(26,7)8)29(44-20(5)37)24(16)25(32(40)41)22-10-12-23(42-9)13-11-22/h10-14,17-18,24-29,31H,15H2,1-9H3,(H,40,41) |
| InChIKey | ZORKOOTXTDHHOD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 155.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|