C31H42O10 — CID 163031220
[(1R,3S,4S,5R,7S,8R,9R,10E,12S,13S,14S)-4,9,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate (PubChem CID 163031220) has the molecular formula C31H42O10 and a molecular weight of 574.67 g/mol. Its IUPAC name is [(1R,3S,4S,5R,7S,8R,9R,10E,12S,13S,14S)-4,9,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,3S,4S,5R,7S,8R,9R,10E,12S,13S,14S)-4,9,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163031220 |
| Molecular Formula | C31H42O10 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | [(1R,3S,4S,5R,7S,8R,9R,10E,12S,13S,14S)-4,9,13-triacetyloxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1[C@H]2[C@@H]([C@H](OC(C)=O)[C@H](C)C(=O)[C@@]34C[C@H](C)[C@H](OC(C)=O)[C@]3(/C=C(\C)[C@H]1OC(C)=O)O4)C2(C)C |
| InChI | InChI=1S/C31H42O10/c1-11-14(2)28(36)40-25-22-21(29(22,9)10)24(38-19(7)33)17(5)26(35)30-13-16(4)27(39-20(8)34)31(30,41-30)12-15(3)23(25)37-18(6)32/h11-12,16-17,21-25,27H,13H2,1-10H3/b14-11+,15-12+/t16-,17-,21-,22+,23+,24+,25+,27-,30-,31-/m0/s1 |
| InChIKey | UITHKGLLFMAUBX-NDEIKLGZSA-N |
| XLogP | 3.64 |
| TPSA | 134.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|