C28H40O10 — CID 21159768
[(10Z)-8,9,13-triacetyloxy-2-hydroxy-3,6,6,10,14-pentamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-4-yl] acetate (PubChem CID 21159768) has the molecular formula C28H40O10 and a molecular weight of 536.62 g/mol. Its IUPAC name is [(10Z)-8,9,13-triacetyloxy-2-hydroxy-3,6,6,10,14-pentamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-4-yl] acetate.
| Compound Name | [(10Z)-8,9,13-triacetyloxy-2-hydroxy-3,6,6,10,14-pentamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-4-yl] acetate |
|---|---|
| PubChem CID | 21159768 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | [(10Z)-8,9,13-triacetyloxy-2-hydroxy-3,6,6,10,14-pentamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-4-yl] acetate |
| SMILES | CC(=O)OC1/C(C)=C\C23OC2(CC(C)C3OC(C)=O)C(O)C(C)C(OC(C)=O)C2C(C1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C28H40O10/c1-12-10-28-25(37-18(7)32)13(2)11-27(28,38-28)24(33)14(3)22(35-16(5)30)19-20(26(19,8)9)23(36-17(6)31)21(12)34-15(4)29/h10,13-14,19-25,33H,11H2,1-9H3/b12-10- |
| InChIKey | BPNFPYKEVDHBFP-BENRWUELSA-N |
| XLogP | 2.49 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|