C27H38O8 — CID 23255566
[(1R,3R,4R,5R,7S,8S,9R,10E,12S,13S,14S)-4-acetyloxy-9,13-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate (PubChem CID 23255566) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is [(1R,3R,4R,5R,7S,8S,9R,10E,12S,13S,14S)-4-acetyloxy-9,13-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,3R,4R,5R,7S,8S,9R,10E,12S,13S,14S)-4-acetyloxy-9,13-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 23255566 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [(1R,3R,4R,5R,7S,8S,9R,10E,12S,13S,14S)-4-acetyloxy-9,13-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1[C@H]2[C@@H]([C@@H](OC(C)=O)[C@@H](C)C(=O)[C@@]34C[C@H](C)[C@H](O)[C@]3(/C=C(\C)[C@H]1O)O4)C2(C)C |
| InChI | InChI=1S/C27H38O8/c1-9-12(2)24(32)34-21-18-17(25(18,7)8)20(33-16(6)28)15(5)23(31)27-11-14(4)22(30)26(27,35-27)10-13(3)19(21)29/h9-10,14-15,17-22,29-30H,11H2,1-8H3/b12-9+,13-10+/t14-,15+,17-,18+,19+,20-,21-,22-,26-,27-/m0/s1 |
| InChIKey | LXAAZEDGZDPXIG-ICRFFOOESA-N |
| XLogP | 2.50 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|