C21H32O5 — CID 163089183
(1R,3R,4R,5R,7S,8S,9R,10Z,12R,13S,14S)-4,8,9-trihydroxy-3,6,6,10,13,14-hexamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-2-one (PubChem CID 163089183) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is (1R,3R,4R,5R,7S,8S,9R,10Z,12R,13S,14S)-4,8,9-trihydroxy-3,6,6,10,13,14-hexamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-2-one.
| Compound Name | (1R,3R,4R,5R,7S,8S,9R,10Z,12R,13S,14S)-4,8,9-trihydroxy-3,6,6,10,13,14-hexamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-2-one |
|---|---|
| PubChem CID | 163089183 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1R,3R,4R,5R,7S,8S,9R,10Z,12R,13S,14S)-4,8,9-trihydroxy-3,6,6,10,13,14-hexamethyl-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-2-one |
| SMILES | C/C1=C/[C@@]23O[C@@]2(C[C@H](C)[C@@H]3C)C(=O)[C@H](C)[C@H](O)[C@@H]2[C@H]([C@H](O)[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C21H32O5/c1-9-7-21-18(25)11(3)16(23)13-14(19(13,5)6)17(24)15(22)10(2)8-20(21,26-21)12(9)4/h8-9,11-17,22-24H,7H2,1-6H3/b10-8-/t9-,11+,12-,13-,14+,15+,16-,17-,20-,21-/m0/s1 |
| InChIKey | LDHVXLJFWFBOMR-IQNJBHJESA-N |
| XLogP | 1.69 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|