C33H40O11 — CID 162982842
[4,9,13-triacetyloxy-6-(hydroxymethyl)-3,6,10,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate (PubChem CID 162982842) has the molecular formula C33H40O11 and a molecular weight of 612.67 g/mol. Its IUPAC name is [4,9,13-triacetyloxy-6-(hydroxymethyl)-3,6,10,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate.
| Compound Name | [4,9,13-triacetyloxy-6-(hydroxymethyl)-3,6,10,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate |
|---|---|
| PubChem CID | 162982842 |
| Molecular Formula | C33H40O11 |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | [4,9,13-triacetyloxy-6-(hydroxymethyl)-3,6,10,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate |
| SMILES | CC(=O)OC1C(C)=CC23OC2(CC(C)C3OC(C)=O)C(=O)C(C)C(OC(C)=O)C2C(C1OC(=O)c1ccccc1)C2(C)CO |
| InChI | InChI=1S/C33H40O11/c1-16-13-33-29(42-21(6)37)17(2)14-32(33,44-33)28(38)18(3)26(41-20(5)36)23-24(31(23,7)15-34)27(25(16)40-19(4)35)43-30(39)22-11-9-8-10-12-22/h8-13,17-18,23-27,29,34H,14-15H2,1-7H3 |
| InChIKey | HQNSYEBVSCFDMN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 155.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|