C28H38O7 — CID 177429971
[(1R,2E,4S,7Z,9S,11S,13R,14R)-14-acetyloxy-5-methoxy-3,9,13-trimethyl-10-oxo-6-prop-1-en-2-yl-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 177429971) has the molecular formula C28H38O7 and a molecular weight of 486.61 g/mol. Its IUPAC name is [(1R,2E,4S,7Z,9S,11S,13R,14R)-14-acetyloxy-5-methoxy-3,9,13-trimethyl-10-oxo-6-prop-1-en-2-yl-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2E,4S,7Z,9S,11S,13R,14R)-14-acetyloxy-5-methoxy-3,9,13-trimethyl-10-oxo-6-prop-1-en-2-yl-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 177429971 |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | [(1R,2E,4S,7Z,9S,11S,13R,14R)-14-acetyloxy-5-methoxy-3,9,13-trimethyl-10-oxo-6-prop-1-en-2-yl-15-oxatricyclo[9.3.1.01,11]pentadeca-2,7-dien-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C)C1/C=C\[C@H](C)C(=O)[C@]23C[C@@H](C)[C@@H](OC(C)=O)[C@@]2(/C=C(\C)[C@H](OC(=O)/C(C)=C\C)C1OC)O3 |
| InChI | InChI=1S/C28H38O7/c1-10-16(4)26(31)34-22-18(6)13-28-25(33-20(8)29)19(7)14-27(28,35-28)24(30)17(5)11-12-21(15(2)3)23(22)32-9/h10-13,17,19,21-23,25H,2,14H2,1,3-9H3/b12-11-,16-10-,18-13+/t17-,19+,21?,22-,23?,25+,27+,28+/m0/s1 |
| InChIKey | OPARQFUIZRQPCQ-QRJJWWRYSA-N |
| XLogP | 4.27 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|