C28H38O11 — CID 536452
(5,6,16-triacetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3,17-dioxapentacyclo[11.3.1.01,13.02,4.07,9]heptadecan-10-yl) acetate (PubChem CID 536452) has the molecular formula C28H38O11 and a molecular weight of 550.60 g/mol. Its IUPAC name is (5,6,16-triacetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3,17-dioxapentacyclo[11.3.1.01,13.02,4.07,9]heptadecan-10-yl) acetate.
| Compound Name | (5,6,16-triacetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3,17-dioxapentacyclo[11.3.1.01,13.02,4.07,9]heptadecan-10-yl) acetate |
|---|---|
| PubChem CID | 536452 |
| Molecular Formula | C28H38O11 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | (5,6,16-triacetyloxy-4,8,8,11,15-pentamethyl-12-oxo-3,17-dioxapentacyclo[11.3.1.01,13.02,4.07,9]heptadecan-10-yl) acetate |
| SMILES | CC(=O)OC1C(C)C(=O)C23CC(C)C(OC(C)=O)C2(O3)C2OC2(C)C(OC(C)=O)C(OC(C)=O)C2C1C2(C)C |
| InChI | InChI=1S/C28H38O11/c1-11-10-27-21(33)12(2)19(34-13(3)29)17-18(25(17,7)8)20(35-14(4)30)23(37-16(6)32)26(9)24(38-26)28(27,39-27)22(11)36-15(5)31/h11-12,17-20,22-24H,10H2,1-9H3 |
| InChIKey | KUIGQUDYDNTYML-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 147.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|