C16H22O3 — CID 70364620
(4-hydroxy-3,3,5-trimethylcyclohexyl) benzoate (PubChem CID 70364620) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4-hydroxy-3,3,5-trimethylcyclohexyl) benzoate.
| Compound Name | (4-hydroxy-3,3,5-trimethylcyclohexyl) benzoate |
|---|---|
| PubChem CID | 70364620 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (4-hydroxy-3,3,5-trimethylcyclohexyl) benzoate |
| SMILES | CC1CC(OC(=O)c2ccccc2)CC(C)(C)C1O |
| InChI | InChI=1S/C16H22O3/c1-11-9-13(10-16(2,3)14(11)17)19-15(18)12-7-5-4-6-8-12/h4-8,11,13-14,17H,9-10H2,1-3H3 |
| InChIKey | AGRXJGYLNMSDGK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |