C19H31NO2 — CID 130476048
butane;[(4R,6S)-2,2,6-trimethylpiperidin-4-yl] benzoate (PubChem CID 130476048) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is butane;[(4R,6S)-2,2,6-trimethylpiperidin-4-yl] benzoate.
| Compound Name | butane;[(4R,6S)-2,2,6-trimethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 130476048 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | butane;[(4R,6S)-2,2,6-trimethylpiperidin-4-yl] benzoate |
| SMILES | CCCC.C[C@H]1C[C@@H](OC(=O)c2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C15H21NO2.C4H10/c1-11-9-13(10-15(2,3)16-11)18-14(17)12-7-5-4-6-8-12;1-3-4-2/h4-8,11,13,16H,9-10H2,1-3H3;3-4H2,1-2H3/t11-,13+;/m0./s1 |
| InChIKey | ALXGOCLWPZQMGA-STEACBGWSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |