C27H43NO4 — CID 159218803
(2,2,6,6-tetramethylpiperidin-4-yl) benzoate;undecane-2,4-dione (PubChem CID 159218803) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) benzoate;undecane-2,4-dione.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) benzoate;undecane-2,4-dione |
|---|---|
| PubChem CID | 159218803 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) benzoate;undecane-2,4-dione |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1.CCCCCCCC(=O)CC(C)=O |
| InChI | InChI=1S/C16H23NO2.C11H20O2/c1-15(2)10-13(11-16(3,4)17-15)19-14(18)12-8-6-5-7-9-12;1-3-4-5-6-7-8-11(13)9-10(2)12/h5-9,13,17H,10-11H2,1-4H3;3-9H2,1-2H3 |
| InChIKey | KRKOMIONFHGLQC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|