C34H46N2O6 — CID 118874362
(2,2,6,6-tetramethylpiperidin-4-yl) 4-[(Z)-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenoxy]ethenoxy]benzoate (PubChem CID 118874362) has the molecular formula C34H46N2O6 and a molecular weight of 578.75 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 4-[(Z)-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenoxy]ethenoxy]benzoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-[(Z)-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenoxy]ethenoxy]benzoate |
|---|---|
| PubChem CID | 118874362 |
| Molecular Formula | C34H46N2O6 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-[(Z)-2-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenoxy]ethenoxy]benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(O/C=C\Oc3ccc(C(=O)OC4CC(C)(C)NC(C)(C)C4)cc3)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C34H46N2O6/c1-31(2)19-27(20-32(3,4)35-31)41-29(37)23-9-13-25(14-10-23)39-17-18-40-26-15-11-24(12-16-26)30(38)42-28-21-33(5,6)36-34(7,8)22-28/h9-18,27-28,35-36H,19-22H2,1-8H3/b18-17- |
| InChIKey | OGNRFZSIDQFPLP-ZCXUNETKSA-N |
| XLogP | 6.55 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|