C30H42N2O4 — CID 118874290
bis(2,2,6,6-tetramethylpiperidin-4-yl) naphthalene-2,7-dicarboxylate (PubChem CID 118874290) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) naphthalene-2,7-dicarboxylate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) naphthalene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 118874290 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) naphthalene-2,7-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccc3ccc(C(=O)OC4CC(C)(C)NC(C)(C)C4)cc3c2)CC(C)(C)N1 |
| InChI | InChI=1S/C30H42N2O4/c1-27(2)15-23(16-28(3,4)31-27)35-25(33)20-11-9-19-10-12-21(14-22(19)13-20)26(34)36-24-17-29(5,6)32-30(7,8)18-24/h9-14,23-24,31-32H,15-18H2,1-8H3 |
| InChIKey | HTYRUZKTHKXRDE-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |