C40H48N2O4 — CID 118874333
(2,2,6,6-tetramethylpiperidin-4-yl) 8-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylnaphthalen-2-yl]naphthalene-1-carboxylate (PubChem CID 118874333) has the molecular formula C40H48N2O4 and a molecular weight of 620.83 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 8-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylnaphthalen-2-yl]naphthalene-1-carboxylate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 8-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylnaphthalen-2-yl]naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 118874333 |
| Molecular Formula | C40H48N2O4 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 8-[6-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylnaphthalen-2-yl]naphthalene-1-carboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccc3cc(-c4cccc5cccc(C(=O)OC6CC(C)(C)NC(C)(C)C6)c45)ccc3c2)CC(C)(C)N1 |
| InChI | InChI=1S/C40H48N2O4/c1-37(2)21-30(22-38(3,4)41-37)45-35(43)29-18-16-26-19-28(17-15-27(26)20-29)32-13-9-11-25-12-10-14-33(34(25)32)36(44)46-31-23-39(5,6)42-40(7,8)24-31/h9-20,30-31,41-42H,21-24H2,1-8H3 |
| InChIKey | RSBBLCJVUSNBRZ-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |