C18H24N2O2 — CID 54385727
(2,2,6,6-tetramethylpiperidin-4-yl) 1H-indole-2-carboxylate (PubChem CID 54385727) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 1H-indole-2-carboxylate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 54385727 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 1H-indole-2-carboxylate |
| SMILES | CC1(C)CC(OC(=O)c2cc3ccccc3[nH]2)CC(C)(C)N1 |
| InChI | InChI=1S/C18H24N2O2/c1-17(2)10-13(11-18(3,4)20-17)22-16(21)15-9-12-7-5-6-8-14(12)19-15/h5-9,13,19-20H,10-11H2,1-4H3 |
| InChIKey | VDCGCCQZYIPCRZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |