C42H60FN3O6 — CID 118874491
bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-[3-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]benzene-1,2-dicarboxylate (PubChem CID 118874491) has the molecular formula C42H60FN3O6 and a molecular weight of 721.96 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-[3-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]benzene-1,2-dicarboxylate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-[3-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118874491 |
| Molecular Formula | C42H60FN3O6 |
| Molecular Weight | 721.96 g/mol |
| Exact Mass | 721.45 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-[3-fluoro-4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]benzene-1,2-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(-c3ccc(C(=O)OC4CC(C)(C)NC(C)(C)C4)c(C(=O)OC4CC(C)(C)NC(C)(C)C4)c3)cc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C42H60FN3O6/c1-37(2)19-27(20-38(3,4)44-37)50-34(47)30-15-13-25(17-32(30)36(49)52-29-23-41(9,10)46-42(11,12)24-29)26-14-16-31(33(43)18-26)35(48)51-28-21-39(5,6)45-40(7,8)22-28/h13-18,27-29,44-46H,19-24H2,1-12H3 |
| InChIKey | AWYNEVQULQNNEQ-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.96 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|