C30H42N4O4 — CID 118874514
(2,2,6,6-tetramethylpiperidin-4-yl) 5-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]pyrimidine-2-carboxylate (PubChem CID 118874514) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 5-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]pyrimidine-2-carboxylate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 5-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 118874514 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 5-[4-(2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylphenyl]pyrimidine-2-carboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(-c3cnc(C(=O)OC4CC(C)(C)NC(C)(C)C4)nc3)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C30H42N4O4/c1-27(2)13-22(14-28(3,4)33-27)37-25(35)20-11-9-19(10-12-20)21-17-31-24(32-18-21)26(36)38-23-15-29(5,6)34-30(7,8)16-23/h9-12,17-18,22-23,33-34H,13-16H2,1-8H3 |
| InChIKey | VZAAFMBDWNRMCC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |