C21H23N5O2 — CID 168610779
(2,2,6,6-tetramethylpiperidin-4-yl) 4-(1,2,2-tricyanoethenylamino)benzoate (PubChem CID 168610779) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 4-(1,2,2-tricyanoethenylamino)benzoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-(1,2,2-tricyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168610779 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-(1,2,2-tricyanoethenylamino)benzoate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(NC(C#N)=C(C#N)C#N)cc2)CC(C)(C)N1 |
| InChI | InChI=1S/C21H23N5O2/c1-20(2)9-17(10-21(3,4)26-20)28-19(27)14-5-7-16(8-6-14)25-18(13-24)15(11-22)12-23/h5-8,17,25-26H,9-10H2,1-4H3 |
| InChIKey | PLEJTKNJCMBESJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|