C11H18N2O2 — CID 87076911
(2,2,6,6-tetramethylpiperidin-4-yl) cyanoformate (PubChem CID 87076911) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) cyanoformate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) cyanoformate |
|---|---|
| PubChem CID | 87076911 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) cyanoformate |
| SMILES | CC1(C)CC(OC(=O)C#N)CC(C)(C)N1 |
| InChI | InChI=1S/C11H18N2O2/c1-10(2)5-8(15-9(14)7-12)6-11(3,4)13-10/h8,13H,5-6H2,1-4H3 |
| InChIKey | MJRCYFVNXFKEOG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|