C12H20NO3- — CID 21330422
2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyprop-2-enoate (PubChem CID 21330422) has the molecular formula C12H20NO3- and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyprop-2-enoate.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyprop-2-enoate |
|---|---|
| PubChem CID | 21330422 |
| Molecular Formula | C12H20NO3- |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)oxyprop-2-enoate |
| SMILES | C=C(OC1CC(C)(C)NC(C)(C)C1)C(=O)[O-] |
| InChI | InChI=1S/C12H21NO3/c1-8(10(14)15)16-9-6-11(2,3)13-12(4,5)7-9/h9,13H,1,6-7H2,2-5H3,(H,14,15)/p-1 |
| InChIKey | SQGQMAJDTOPRJD-UHFFFAOYSA-M |
| XLogP | 0.58 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|