C41H77N3O6 — CID 161160145
bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;(2,2,6,6-tetramethylpiperidin-4-yl) butanoate (PubChem CID 161160145) has the molecular formula C41H77N3O6 and a molecular weight of 708.08 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;(2,2,6,6-tetramethylpiperidin-4-yl) butanoate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;(2,2,6,6-tetramethylpiperidin-4-yl) butanoate |
|---|---|
| PubChem CID | 161160145 |
| Molecular Formula | C41H77N3O6 |
| Molecular Weight | 708.08 g/mol |
| Exact Mass | 707.58 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate;(2,2,6,6-tetramethylpiperidin-4-yl) butanoate |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.CCCC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C28H52N2O4.C13H25NO2/c1-25(2)17-21(18-26(3,4)29-25)33-23(31)15-13-11-9-10-12-14-16-24(32)34-22-19-27(5,6)30-28(7,8)20-22;1-6-7-11(15)16-10-8-12(2,3)14-13(4,5)9-10/h21-22,29-30H,9-20H2,1-8H3;10,14H,6-9H2,1-5H3 |
| InChIKey | UPUVXRYAJDEHJU-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.08 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|