C18H31NO4 — CID 90295268
(2,2,6,6-tetramethylpiperidin-4-yl) 6-prop-2-enoyloxyhexanoate (PubChem CID 90295268) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 6-prop-2-enoyloxyhexanoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 6-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 90295268 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 6-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)OCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C18H31NO4/c1-6-15(20)22-11-9-7-8-10-16(21)23-14-12-17(2,3)19-18(4,5)13-14/h6,14,19H,1,7-13H2,2-5H3 |
| InChIKey | XSXGQEKUYNZAJK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|