C30H42O12 — CID 118150684
[(3S,4R)-3,4-bis(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate (PubChem CID 118150684) has the molecular formula C30H42O12 and a molecular weight of 594.65 g/mol. Its IUPAC name is [(3S,4R)-3,4-bis(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate.
| Compound Name | [(3S,4R)-3,4-bis(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate |
|---|---|
| PubChem CID | 118150684 |
| Molecular Formula | C30H42O12 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | [(3S,4R)-3,4-bis(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate |
| SMILES | C=CC(=O)OCCCCC(=O)OC1CC[C@@H](OC(=O)CCCCOC(=O)C=C)[C@@H](OC(=O)CCCCOC(=O)C=C)C1 |
| InChI | InChI=1S/C30H42O12/c1-4-25(31)37-18-10-7-13-28(34)40-22-16-17-23(41-29(35)14-8-11-19-38-26(32)5-2)24(21-22)42-30(36)15-9-12-20-39-27(33)6-3/h4-6,22-24H,1-3,7-21H2/t22?,23-,24+/m1/s1 |
| InChIKey | LKZVRKSOROYMME-XQFMJXHWSA-N |
| XLogP | 3.60 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|