C36H48O18 — CID 118460578
[(3R,4S,5R)-4-(5-oxaldehydoyloxypentanoyloxy)-5,6-bis(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-prop-2-enoyloxypentanoate (PubChem CID 118460578) has the molecular formula C36H48O18 and a molecular weight of 768.76 g/mol. Its IUPAC name is [(3R,4S,5R)-4-(5-oxaldehydoyloxypentanoyloxy)-5,6-bis(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-prop-2-enoyloxypentanoate.
| Compound Name | [(3R,4S,5R)-4-(5-oxaldehydoyloxypentanoyloxy)-5,6-bis(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-prop-2-enoyloxypentanoate |
|---|---|
| PubChem CID | 118460578 |
| Molecular Formula | C36H48O18 |
| Molecular Weight | 768.76 g/mol |
| Exact Mass | 768.28 |
| IUPAC Name | [(3R,4S,5R)-4-(5-oxaldehydoyloxypentanoyloxy)-5,6-bis(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-prop-2-enoyloxypentanoate |
| SMILES | C=CC(=O)OCCCCC(=O)OC1OC[C@@H](OC(=O)CCCCOC(=O)C=C)[C@H](OC(=O)CCCCOC(=O)C=O)[C@H]1OC(=O)CCCCOC(=O)C=C |
| InChI | InChI=1S/C36H48O18/c1-4-26(38)46-19-11-7-15-29(41)51-25-24-50-36(54-32(44)18-10-13-21-48-28(40)6-3)35(53-31(43)17-8-12-20-47-27(39)5-2)34(25)52-30(42)16-9-14-22-49-33(45)23-37/h4-6,23,25,34-36H,1-3,7-22,24H2/t25-,34+,35-,36?/m1/s1 |
| InChIKey | PZSPDIWSOCVCTB-ZIXDAOJYSA-N |
| XLogP | 2.23 |
| TPSA | 236.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|