C32H44O18 — CID 146628844
bis[(2S,3R,4S,5S)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate (PubChem CID 146628844) has the molecular formula C32H44O18 and a molecular weight of 716.69 g/mol. Its IUPAC name is bis[(2S,3R,4S,5S)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate.
| Compound Name | bis[(2S,3R,4S,5S)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 146628844 |
| Molecular Formula | C32H44O18 |
| Molecular Weight | 716.69 g/mol |
| Exact Mass | 716.25 |
| IUPAC Name | bis[(2S,3R,4S,5S)-3,4,5-tri(propanoyloxy)oxan-2-yl] (E)-but-2-enedioate |
| SMILES | CCC(=O)O[C@@H]1[C@@H](OC(=O)CC)[C@H](OC(=O)/C=C/C(=O)O[C@@H]2OC[C@H](OC(=O)CC)[C@H](OC(=O)CC)[C@H]2OC(=O)CC)OC[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C32H44O18/c1-7-19(33)43-17-15-41-31(29(47-23(37)11-5)27(17)45-21(35)9-3)49-25(39)13-14-26(40)50-32-30(48-24(38)12-6)28(46-22(36)10-4)18(16-42-32)44-20(34)8-2/h13-14,17-18,27-32H,7-12,15-16H2,1-6H3/b14-13+/t17-,18-,27-,28-,29+,30+,31-,32-/m0/s1 |
| InChIKey | ZFPGCYJTYXKCKD-KZSVOZEISA-N |
| XLogP | 1.27 |
| TPSA | 228.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.69 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|