C18H24O11 — CID 146628891
(E)-4-oxo-4-[(2S,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]oxybut-2-enoic acid (PubChem CID 146628891) has the molecular formula C18H24O11 and a molecular weight of 416.38 g/mol. Its IUPAC name is (E)-4-oxo-4-[(2S,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]oxybut-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[(2S,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]oxybut-2-enoic acid |
|---|---|
| PubChem CID | 146628891 |
| Molecular Formula | C18H24O11 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (E)-4-oxo-4-[(2S,3R,4R,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]oxybut-2-enoic acid |
| SMILES | CCC(=O)O[C@H]1[C@H](OC(=O)/C=C/C(=O)O)OC[C@@H](OC(=O)CC)[C@H]1OC(=O)CC |
| InChI | InChI=1S/C18H24O11/c1-4-12(21)26-10-9-25-18(29-15(24)8-7-11(19)20)17(28-14(23)6-3)16(10)27-13(22)5-2/h7-8,10,16-18H,4-6,9H2,1-3H3,(H,19,20)/b8-7+/t10-,16-,17-,18+/m1/s1 |
| InChIKey | WPXSIYRXZZZUTK-YGMKSVAVSA-N |
| XLogP | 0.49 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|