C17H26O9 — CID 156573027
2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid (PubChem CID 156573027) has the molecular formula C17H26O9 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid.
| Compound Name | 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 156573027 |
| Molecular Formula | C17H26O9 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid |
| SMILES | CCC(=O)OC1C(C(C)C(=O)O)OC[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C17H26O9/c1-5-11(18)24-10-8-23-14(9(4)17(21)22)16(26-13(20)7-3)15(10)25-12(19)6-2/h9-10,14-16H,5-8H2,1-4H3,(H,21,22)/t9?,10-,14?,15+,16?/m1/s1 |
| InChIKey | YRVFOLTUVAKIQP-RRWFLNAZSA-N |
| XLogP | 1.07 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|