2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid

C17H26O9 — CID 156573027

IUPAC2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid
SMILESCCC(=O)OC1C(C(C)C(=O)O)OC[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC
InChIInChI=1S/C17H26O9/c1-5-11(18)24-10-8-23-14(9(4)17(21)22)16(26-13(20)7-3)15(10)25-12(19)6-2/h9-10,14-16H,5-8H2,1-4H3,(H,21,22)/t9?,10-,14?,15+,16?/m1/s1
InChIKeyYRVFOLTUVAKIQP-RRWFLNAZSA-N
MW374.39 g/mol
LogP1.07
Rot. Bonds8

About 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid

2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid (PubChem CID 156573027) has the molecular formula C17H26O9 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid.

Molecular Properties

Compound Name2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid
PubChem CID156573027
Molecular FormulaC17H26O9
Molecular Weight374.39 g/mol
Exact Mass374.16
IUPAC Name2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid
SMILESCCC(=O)OC1C(C(C)C(=O)O)OC[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC
InChIInChI=1S/C17H26O9/c1-5-11(18)24-10-8-23-14(9(4)17(21)22)16(26-13(20)7-3)15(10)25-12(19)6-2/h9-10,14-16H,5-8H2,1-4H3,(H,21,22)/t9?,10-,14?,15+,16?/m1/s1
InChIKeyYRVFOLTUVAKIQP-RRWFLNAZSA-N
XLogP1.07
TPSA125.43 Ų
H-Bond Donors1
H-Bond Acceptors8
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500374.39
LogP ≤ 51.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}

Analyze 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid?
The IUPAC name of 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid (CID 156573027) is 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid.
What is the SMILES notation for 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid?
The canonical SMILES for 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid is CCC(=O)OC1C(C(C)C(=O)O)OC[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC.
What is the InChIKey of 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid?
The InChIKey is YRVFOLTUVAKIQP-RRWFLNAZSA-N. The full InChI is InChI=1S/C17H26O9/c1-5-11(18)24-10-8-23-14(9(4)17(21)22)16(26-13(20)7-3)15(10)25-12(19)6-2/h9-10,14-16H,5-8H2,1-4H3,(H,21,22)/t9?,10-,14?,15+,16?/m1/s1.
What are the key properties of 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid?
2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid has a molecular weight of 374.39 g/mol, XLogP of 1.07, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl]propanoic acid is sourced from PubChem (CID 156573027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).