C22H36O9 — CID 154935821
[(2R)-2-butanoyloxy-2-[(3R,4S)-3,4-di(butanoyloxy)oxolan-2-yl]ethyl] butanoate (PubChem CID 154935821) has the molecular formula C22H36O9 and a molecular weight of 444.52 g/mol. Its IUPAC name is [(2R)-2-butanoyloxy-2-[(3R,4S)-3,4-di(butanoyloxy)oxolan-2-yl]ethyl] butanoate.
| Compound Name | [(2R)-2-butanoyloxy-2-[(3R,4S)-3,4-di(butanoyloxy)oxolan-2-yl]ethyl] butanoate |
|---|---|
| PubChem CID | 154935821 |
| Molecular Formula | C22H36O9 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | [(2R)-2-butanoyloxy-2-[(3R,4S)-3,4-di(butanoyloxy)oxolan-2-yl]ethyl] butanoate |
| SMILES | CCCC(=O)OC[C@@H](OC(=O)CCC)C1OC[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C22H36O9/c1-5-9-17(23)27-13-15(29-18(24)10-6-2)21-22(31-20(26)12-8-4)16(14-28-21)30-19(25)11-7-3/h15-16,21-22H,5-14H2,1-4H3/t15-,16+,21?,22-/m1/s1 |
| InChIKey | AUBUZTDFRJJDDE-MFGZZSJASA-N |
| XLogP | 2.86 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|