C13H20O8 — CID 170851439
[(2R)-2-acetyloxy-2-[(2S,3R,4S)-4-acetyloxy-3-methoxyoxolan-2-yl]ethyl] acetate (PubChem CID 170851439) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(2S,3R,4S)-4-acetyloxy-3-methoxyoxolan-2-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(2S,3R,4S)-4-acetyloxy-3-methoxyoxolan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 170851439 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(2S,3R,4S)-4-acetyloxy-3-methoxyoxolan-2-yl]ethyl] acetate |
| SMILES | CO[C@H]1[C@H]([C@@H](COC(C)=O)OC(C)=O)OC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H20O8/c1-7(14)18-5-11(21-9(3)16)13-12(17-4)10(6-19-13)20-8(2)15/h10-13H,5-6H2,1-4H3/t10-,11+,12+,13-/m0/s1 |
| InChIKey | FKDNQUUYBJZAIS-LOWDOPEQSA-N |
| XLogP | -0.17 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|