C18H26O12 — CID 14216846
[(2S)-2-acetyloxy-2-[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl] acetate (PubChem CID 14216846) has the molecular formula C18H26O12 and a molecular weight of 434.39 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-2-[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl] acetate.
| Compound Name | [(2S)-2-acetyloxy-2-[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 14216846 |
| Molecular Formula | C18H26O12 |
| Molecular Weight | 434.39 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [(2S)-2-acetyloxy-2-[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-methoxyoxan-2-yl]ethyl] acetate |
| SMILES | CO[C@H]1O[C@H]([C@H](COC(C)=O)OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H26O12/c1-8(19)25-7-13(26-9(2)20)14-15(27-10(3)21)16(28-11(4)22)17(29-12(5)23)18(24-6)30-14/h13-18H,7H2,1-6H3/t13-,14+,15+,16-,17-,18-/m0/s1 |
| InChIKey | DQNITYPHTXMCTK-IZPLOLCNSA-N |
| XLogP | -0.35 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|