C16H24O10S — CID 134916451
[(2S,3S,4S,5R,6S)-3,5-diacetyloxy-2-[acetyloxy(methylsulfanyl)methyl]-6-methoxyoxan-4-yl] acetate (PubChem CID 134916451) has the molecular formula C16H24O10S and a molecular weight of 408.43 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-3,5-diacetyloxy-2-[acetyloxy(methylsulfanyl)methyl]-6-methoxyoxan-4-yl] acetate.
| Compound Name | [(2S,3S,4S,5R,6S)-3,5-diacetyloxy-2-[acetyloxy(methylsulfanyl)methyl]-6-methoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 134916451 |
| Molecular Formula | C16H24O10S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-3,5-diacetyloxy-2-[acetyloxy(methylsulfanyl)methyl]-6-methoxyoxan-4-yl] acetate |
| SMILES | CO[C@H]1O[C@H](C(OC(C)=O)SC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O10S/c1-7(17)22-11-12(23-8(2)18)14(16(27-6)25-10(4)20)26-15(21-5)13(11)24-9(3)19/h11-16H,1-6H3/t11-,12-,13+,14-,15-,16?/m0/s1 |
| InChIKey | NJSSKOGXHHTXMM-UYCJLYLSSA-N |
| XLogP | 0.41 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|