About [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate
[6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate (PubChem CID 568173) has the molecular formula C14H26O8
and a molecular weight of 322.35 g/mol. Its IUPAC name is [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate.
Analyze [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate?
The IUPAC name of [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate (CID 568173) is [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate.
What is the SMILES notation for [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate?
The canonical SMILES for [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate is COCC(OC)C1OC(OC)C(OC(C)=O)C(OC)C1OC.
What is the InChIKey of [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate?
The InChIKey is LRTPRBAUOHMUDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O8/c1-8(15)21-13-12(19-5)11(18-4)10(22-14(13)20-6)9(17-3)7-16-2/h9-14H,7H2,1-6H3.
What are the key properties of [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate?
[6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate has a molecular weight of 322.35 g/mol, XLogP of -0.02, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,2-dimethoxyethyl)-2,4,5-trimethoxyoxan-3-yl] acetate is sourced from PubChem (CID 568173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).