C27H46O16 — CID 22215496
[(2S,3R,4R,5R)-5-acetyloxy-6-[(2S,3S,4S,5S,6R)-5-acetyloxy-6-[(1R)-1-acetyloxy-2-methoxyethyl]-3,4-dimethoxyoxan-2-yl]oxy-2,3,4-trimethoxyhexyl] acetate (PubChem CID 22215496) has the molecular formula C27H46O16 and a molecular weight of 626.65 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-acetyloxy-6-[(2S,3S,4S,5S,6R)-5-acetyloxy-6-[(1R)-1-acetyloxy-2-methoxyethyl]-3,4-dimethoxyoxan-2-yl]oxy-2,3,4-trimethoxyhexyl] acetate.
| Compound Name | [(2S,3R,4R,5R)-5-acetyloxy-6-[(2S,3S,4S,5S,6R)-5-acetyloxy-6-[(1R)-1-acetyloxy-2-methoxyethyl]-3,4-dimethoxyoxan-2-yl]oxy-2,3,4-trimethoxyhexyl] acetate |
|---|---|
| PubChem CID | 22215496 |
| Molecular Formula | C27H46O16 |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | [(2S,3R,4R,5R)-5-acetyloxy-6-[(2S,3S,4S,5S,6R)-5-acetyloxy-6-[(1R)-1-acetyloxy-2-methoxyethyl]-3,4-dimethoxyoxan-2-yl]oxy-2,3,4-trimethoxyhexyl] acetate |
| SMILES | COC[C@@H](OC(C)=O)[C@H]1O[C@H](OC[C@@H](OC(C)=O)[C@@H](OC)[C@H](OC)[C@H](COC(C)=O)OC)[C@@H](OC)[C@@H](OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H46O16/c1-14(28)38-12-18(33-6)21(34-7)22(35-8)20(41-16(3)30)13-39-27-26(37-10)24(36-9)25(42-17(4)31)23(43-27)19(11-32-5)40-15(2)29/h18-27H,11-13H2,1-10H3/t18-,19+,20+,21+,22+,23+,24-,25+,26-,27-/m0/s1 |
| InChIKey | VKONQTLTKQFVOW-KWPOTZOPSA-N |
| XLogP | -0.19 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|