C15H26O9 — CID 538776
(5,6-diacetyloxy-2,3,4-trimethoxyhexyl) acetate (PubChem CID 538776) has the molecular formula C15H26O9 and a molecular weight of 350.36 g/mol. Its IUPAC name is (5,6-diacetyloxy-2,3,4-trimethoxyhexyl) acetate.
| Compound Name | (5,6-diacetyloxy-2,3,4-trimethoxyhexyl) acetate |
|---|---|
| PubChem CID | 538776 |
| Molecular Formula | C15H26O9 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (5,6-diacetyloxy-2,3,4-trimethoxyhexyl) acetate |
| SMILES | COC(COC(C)=O)C(OC)C(OC)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C15H26O9/c1-9(16)22-7-12(19-4)14(20-5)15(21-6)13(24-11(3)18)8-23-10(2)17/h12-15H,7-8H2,1-6H3 |
| InChIKey | RUAAXNGDIMCTCD-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|