C24H34O16 — CID 10907981
[(2S,3S,4R,5S,6R,7S)-2,3,4,5,6,7,8-heptaacetyloxyoctyl] acetate (PubChem CID 10907981) has the molecular formula C24H34O16 and a molecular weight of 578.52 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R,7S)-2,3,4,5,6,7,8-heptaacetyloxyoctyl] acetate.
| Compound Name | [(2S,3S,4R,5S,6R,7S)-2,3,4,5,6,7,8-heptaacetyloxyoctyl] acetate |
|---|---|
| PubChem CID | 10907981 |
| Molecular Formula | C24H34O16 |
| Molecular Weight | 578.52 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [(2S,3S,4R,5S,6R,7S)-2,3,4,5,6,7,8-heptaacetyloxyoctyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C24H34O16/c1-11(25)33-9-19(35-13(3)27)21(37-15(5)29)23(39-17(7)31)24(40-18(8)32)22(38-16(6)30)20(36-14(4)28)10-34-12(2)26/h19-24H,9-10H2,1-8H3/t19-,20-,21-,22+,23+,24-/m0/s1 |
| InChIKey | QJFMZJKGMNLZHZ-NOGMDXJMSA-N |
| XLogP | -0.30 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.52 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|