C17H27NO10 — CID 89305174
[(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6-(methylamino)hexyl] acetate (PubChem CID 89305174) has the molecular formula C17H27NO10 and a molecular weight of 405.40 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6-(methylamino)hexyl] acetate.
| Compound Name | [(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6-(methylamino)hexyl] acetate |
|---|---|
| PubChem CID | 89305174 |
| Molecular Formula | C17H27NO10 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [(2S,3S,4S,5R)-2,3,4,5-tetraacetyloxy-6-(methylamino)hexyl] acetate |
| SMILES | CNC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H27NO10/c1-9(19)24-8-15(26-11(3)21)17(28-13(5)23)16(27-12(4)22)14(7-18-6)25-10(2)20/h14-18H,7-8H2,1-6H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | XAJUQNHJZOQWLN-QZWWFDLISA-N |
| XLogP | -0.50 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|