C14H22O10 — CID 87557308
[(2S,3R,4R,5R)-2,3,4-triacetyloxy-5,6-dihydroxyhexyl] acetate (PubChem CID 87557308) has the molecular formula C14H22O10 and a molecular weight of 350.32 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2,3,4-triacetyloxy-5,6-dihydroxyhexyl] acetate.
| Compound Name | [(2S,3R,4R,5R)-2,3,4-triacetyloxy-5,6-dihydroxyhexyl] acetate |
|---|---|
| PubChem CID | 87557308 |
| Molecular Formula | C14H22O10 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [(2S,3R,4R,5R)-2,3,4-triacetyloxy-5,6-dihydroxyhexyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](O)CO |
| InChI | InChI=1S/C14H22O10/c1-7(16)21-6-12(22-8(2)17)14(24-10(4)19)13(11(20)5-15)23-9(3)18/h11-15,20H,5-6H2,1-4H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | ICCAXRYQUHEHDT-XJFOESAGSA-N |
| XLogP | -1.30 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|