C16H24O11 — CID 123857051
(3,4,5,6-tetraacetyloxy-2-hydroxyhexyl) acetate (PubChem CID 123857051) has the molecular formula C16H24O11 and a molecular weight of 392.36 g/mol. Its IUPAC name is (3,4,5,6-tetraacetyloxy-2-hydroxyhexyl) acetate.
| Compound Name | (3,4,5,6-tetraacetyloxy-2-hydroxyhexyl) acetate |
|---|---|
| PubChem CID | 123857051 |
| Molecular Formula | C16H24O11 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | (3,4,5,6-tetraacetyloxy-2-hydroxyhexyl) acetate |
| SMILES | CC(=O)OCC(O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C16H24O11/c1-8(17)23-6-13(22)15(26-11(4)20)16(27-12(5)21)14(25-10(3)19)7-24-9(2)18/h13-16,22H,6-7H2,1-5H3 |
| InChIKey | CONMBBGQYUBCPE-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|