C9H18O6 — CID 18642153
[(2R,3R,4R)-4,5-dihydroxy-2,3-dimethoxypentyl] acetate (PubChem CID 18642153) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is [(2R,3R,4R)-4,5-dihydroxy-2,3-dimethoxypentyl] acetate.
| Compound Name | [(2R,3R,4R)-4,5-dihydroxy-2,3-dimethoxypentyl] acetate |
|---|---|
| PubChem CID | 18642153 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [(2R,3R,4R)-4,5-dihydroxy-2,3-dimethoxypentyl] acetate |
| SMILES | CO[C@H]([C@H](O)CO)[C@@H](COC(C)=O)OC |
| InChI | InChI=1S/C9H18O6/c1-6(11)15-5-8(13-2)9(14-3)7(12)4-10/h7-10,12H,4-5H2,1-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | MFGWDGLUPIEQQG-IWSPIJDZSA-N |
| XLogP | -1.07 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |