C13H22O8 — CID 15608108
[(2S,3R,4S)-2,5-diacetyloxy-5-deuterio-3,4-dimethoxypentyl] acetate (PubChem CID 15608108) has the molecular formula C13H22O8 and a molecular weight of 307.32 g/mol. Its IUPAC name is [(2S,3R,4S)-2,5-diacetyloxy-5-deuterio-3,4-dimethoxypentyl] acetate.
| Compound Name | [(2S,3R,4S)-2,5-diacetyloxy-5-deuterio-3,4-dimethoxypentyl] acetate |
|---|---|
| PubChem CID | 15608108 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | [(2S,3R,4S)-2,5-diacetyloxy-5-deuterio-3,4-dimethoxypentyl] acetate |
| SMILES | [2H]C(OC(C)=O)[C@H](OC)[C@@H](OC)[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C13H22O8/c1-8(14)19-6-11(17-4)13(18-5)12(21-10(3)16)7-20-9(2)15/h11-13H,6-7H2,1-5H3/t11-,12-,13+/m0/s1/i6D/t6?,11-,12-,13+ |
| InChIKey | ZKFWJYOWSSHOBN-OKOZJNDVSA-N |
| XLogP | 0.07 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|