C14H26O8 — CID 24745070
[(2R,3R,4S,5S)-5-acetyloxy-1-deuterio-2,3,4,6-tetramethoxyhexyl] acetate (PubChem CID 24745070) has the molecular formula C14H26O8 and a molecular weight of 323.36 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-5-acetyloxy-1-deuterio-2,3,4,6-tetramethoxyhexyl] acetate.
| Compound Name | [(2R,3R,4S,5S)-5-acetyloxy-1-deuterio-2,3,4,6-tetramethoxyhexyl] acetate |
|---|---|
| PubChem CID | 24745070 |
| Molecular Formula | C14H26O8 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [(2R,3R,4S,5S)-5-acetyloxy-1-deuterio-2,3,4,6-tetramethoxyhexyl] acetate |
| SMILES | [2H]C(OC(C)=O)[C@@H](OC)[C@@H](OC)[C@@H](OC)[C@H](COC)OC(C)=O |
| InChI | InChI=1S/C14H26O8/c1-9(15)21-8-11(18-4)13(19-5)14(20-6)12(7-17-3)22-10(2)16/h11-14H,7-8H2,1-6H3/t11-,12+,13-,14+/m1/s1/i8D/t8?,11-,12+,13-,14+ |
| InChIKey | OVCJDQPBVXUBBF-FNAKAWFBSA-N |
| XLogP | 0.17 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |