C14H21NO8 — CID 91751771
[(2S,3S,4S,5R)-3,5-diacetyloxy-5-cyano-1,4-dimethoxypentan-2-yl] acetate (PubChem CID 91751771) has the molecular formula C14H21NO8 and a molecular weight of 331.32 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-3,5-diacetyloxy-5-cyano-1,4-dimethoxypentan-2-yl] acetate.
| Compound Name | [(2S,3S,4S,5R)-3,5-diacetyloxy-5-cyano-1,4-dimethoxypentan-2-yl] acetate |
|---|---|
| PubChem CID | 91751771 |
| Molecular Formula | C14H21NO8 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | [(2S,3S,4S,5R)-3,5-diacetyloxy-5-cyano-1,4-dimethoxypentan-2-yl] acetate |
| SMILES | COC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC)[C@@H](C#N)OC(C)=O |
| InChI | InChI=1S/C14H21NO8/c1-8(16)21-11(6-15)13(20-5)14(23-10(3)18)12(7-19-4)22-9(2)17/h11-14H,7H2,1-5H3/t11-,12+,13+,14+/m1/s1 |
| InChIKey | CODTYEMFRJDDAD-RFGFWPKPSA-N |
| XLogP | -0.03 |
| TPSA | 121.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|