C18H25NO11 — CID 146410232
[(3R,4S,5S)-3,4,6-triacetyloxy-2-(acetyloxymethyl)-5-cyanatohexyl] acetate (PubChem CID 146410232) has the molecular formula C18H25NO11 and a molecular weight of 431.39 g/mol. Its IUPAC name is [(3R,4S,5S)-3,4,6-triacetyloxy-2-(acetyloxymethyl)-5-cyanatohexyl] acetate.
| Compound Name | [(3R,4S,5S)-3,4,6-triacetyloxy-2-(acetyloxymethyl)-5-cyanatohexyl] acetate |
|---|---|
| PubChem CID | 146410232 |
| Molecular Formula | C18H25NO11 |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [(3R,4S,5S)-3,4,6-triacetyloxy-2-(acetyloxymethyl)-5-cyanatohexyl] acetate |
| SMILES | CC(=O)OCC(COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](COC(C)=O)OC#N |
| InChI | InChI=1S/C18H25NO11/c1-10(20)25-6-15(7-26-11(2)21)17(29-13(4)23)18(30-14(5)24)16(28-9-19)8-27-12(3)22/h15-18H,6-8H2,1-5H3/t16-,17+,18+/m0/s1 |
| InChIKey | KAXPPZDVENPFTK-RCCFBDPRSA-N |
| XLogP | 0.02 |
| TPSA | 164.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|