C13H17NO8 — CID 7037283
[(2R,3R,4S)-2,3,4-triacetyloxy-4-cyanobutyl] acetate (PubChem CID 7037283) has the molecular formula C13H17NO8 and a molecular weight of 315.28 g/mol. Its IUPAC name is [(2R,3R,4S)-2,3,4-triacetyloxy-4-cyanobutyl] acetate.
| Compound Name | [(2R,3R,4S)-2,3,4-triacetyloxy-4-cyanobutyl] acetate |
|---|---|
| PubChem CID | 7037283 |
| Molecular Formula | C13H17NO8 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [(2R,3R,4S)-2,3,4-triacetyloxy-4-cyanobutyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](C#N)OC(C)=O |
| InChI | InChI=1S/C13H17NO8/c1-7(15)19-6-12(21-9(3)17)13(22-10(4)18)11(5-14)20-8(2)16/h11-13H,6H2,1-4H3/t11-,12+,13+/m0/s1 |
| InChIKey | YHTPKBYAZJOQCI-YNEHKIRRSA-N |
| XLogP | -0.13 |
| TPSA | 128.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|