C15H23NO9 — CID 163210243
[(2R,3R,4R,5S)-2,3-diacetyloxy-6-cyano-6-hydroxy-4,5-dimethoxyhexyl] acetate (PubChem CID 163210243) has the molecular formula C15H23NO9 and a molecular weight of 361.35 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3-diacetyloxy-6-cyano-6-hydroxy-4,5-dimethoxyhexyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,3-diacetyloxy-6-cyano-6-hydroxy-4,5-dimethoxyhexyl] acetate |
|---|---|
| PubChem CID | 163210243 |
| Molecular Formula | C15H23NO9 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3-diacetyloxy-6-cyano-6-hydroxy-4,5-dimethoxyhexyl] acetate |
| SMILES | CO[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@@H](OC)C(O)C#N |
| InChI | InChI=1S/C15H23NO9/c1-8(17)23-7-12(24-9(2)18)14(25-10(3)19)15(22-5)13(21-4)11(20)6-16/h11-15,20H,7H2,1-5H3/t11?,12-,13+,14-,15-/m1/s1 |
| InChIKey | ZXHLRSOCXIWSLA-ARQSVGKCSA-N |
| XLogP | -0.67 |
| TPSA | 141.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|