C12H24O7 — CID 14825854
[(2S,3R,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexyl] acetate (PubChem CID 14825854) has the molecular formula C12H24O7 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexyl] acetate.
| Compound Name | [(2S,3R,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexyl] acetate |
|---|---|
| PubChem CID | 14825854 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | [(2S,3R,4R,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexyl] acetate |
| SMILES | COC[C@@H](O)[C@@H](OC)[C@H](OC)[C@H](COC(C)=O)OC |
| InChI | InChI=1S/C12H24O7/c1-8(13)19-7-10(16-3)12(18-5)11(17-4)9(14)6-15-2/h9-12,14H,6-7H2,1-5H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | HBRITIZRFPIDOI-WRWGMCAJSA-N |
| XLogP | -0.40 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |