C19H24Cl3NO12 — CID 72769024
[2-acetyloxy-2-[3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]ethyl] acetate (PubChem CID 72769024) has the molecular formula C19H24Cl3NO12 and a molecular weight of 564.76 g/mol. Its IUPAC name is [2-acetyloxy-2-[3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]ethyl] acetate.
| Compound Name | [2-acetyloxy-2-[3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 72769024 |
| Molecular Formula | C19H24Cl3NO12 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 563.04 |
| IUPAC Name | [2-acetyloxy-2-[3,4,5-triacetyloxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]ethyl] acetate |
| SMILES | [H]/N=C(/OC1OC(C(COC(C)=O)OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H24Cl3NO12/c1-7(24)29-6-12(30-8(2)25)13-14(31-9(3)26)15(32-10(4)27)16(33-11(5)28)17(34-13)35-18(23)19(20,21)22/h12-17,23H,6H2,1-5H3/b23-18+ |
| InChIKey | BQUNTZANYGDWTR-PTGBLXJZSA-N |
| XLogP | 1.37 |
| TPSA | 173.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|